C19H20N4O5S — CID 124863935
ethyl 2-[3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]propanoylamino]-1,3-thiazole-4-carboxylate (PubChem CID 124863935) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is ethyl 2-[3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]propanoylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]propanoylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 124863935 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | ethyl 2-[3-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]propanoylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=O)CC[C@H]2NC(=O)N(Cc3ccccc3)C2=O)n1 |
| InChI | InChI=1S/C19H20N4O5S/c1-2-28-17(26)14-11-29-18(20-14)22-15(24)9-8-13-16(25)23(19(27)21-13)10-12-6-4-3-5-7-12/h3-7,11,13H,2,8-10H2,1H3,(H,21,27)(H,20,22,24)/t13-/m1/s1 |
| InChIKey | VENNILFXTJZSIC-CYBMUJFWSA-N |
| XLogP | 2.16 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|