C18H18N4O5S — CID 124864373
methyl 2-[[2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]acetyl]amino]-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 124864373) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is methyl 2-[[2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]acetyl]amino]-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]acetyl]amino]-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 124864373 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | methyl 2-[[2-[(4R)-1-benzyl-2,5-dioxoimidazolidin-4-yl]acetyl]amino]-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NC(=O)C[C@H]2NC(=O)N(Cc3ccccc3)C2=O)sc1C |
| InChI | InChI=1S/C18H18N4O5S/c1-10-14(16(25)27-2)21-17(28-10)20-13(23)8-12-15(24)22(18(26)19-12)9-11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,19,26)(H,20,21,23)/t12-/m1/s1 |
| InChIKey | XTKAAZHUFJPLQV-GFCCVEGCSA-N |
| XLogP | 1.69 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|