C21H20N4O5S — CID 71828808
N-(1,3-benzothiazol-2-yl)-2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 71828808) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 71828808 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](CC(=O)Nc3nc4ccccc4s3)C2=O)cc1OC |
| InChI | InChI=1S/C21H20N4O5S/c1-29-15-8-7-12(9-16(15)30-2)11-25-19(27)14(23-21(25)28)10-18(26)24-20-22-13-5-3-4-6-17(13)31-20/h3-9,14H,10-11H2,1-2H3,(H,23,28)(H,22,24,26)/t14-/m0/s1 |
| InChIKey | SZIHFBLUVNTRST-AWEZNQCLSA-N |
| XLogP | 2.76 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|