C23H22N4O5 — CID 99871291
2-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-quinolin-5-ylacetamide (PubChem CID 99871291) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-quinolin-5-ylacetamide.
| Compound Name | 2-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-quinolin-5-ylacetamide |
|---|---|
| PubChem CID | 99871291 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[(4R)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-quinolin-5-ylacetamide |
| SMILES | COc1ccc(CN2C(=O)N[C@H](CC(=O)Nc3cccc4ncccc34)C2=O)cc1OC |
| InChI | InChI=1S/C23H22N4O5/c1-31-19-9-8-14(11-20(19)32-2)13-27-22(29)18(26-23(27)30)12-21(28)25-17-7-3-6-16-15(17)5-4-10-24-16/h3-11,18H,12-13H2,1-2H3,(H,25,28)(H,26,30)/t18-/m1/s1 |
| InChIKey | YBMLEWOGNWSUGW-GOSISDBHSA-N |
| XLogP | 2.70 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|