C20H22N4O5 — CID 75492502
2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 75492502) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 75492502 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](CC(=O)NCc3cccnc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H22N4O5/c1-28-16-6-5-13(8-17(16)29-2)12-24-19(26)15(23-20(24)27)9-18(25)22-11-14-4-3-7-21-10-14/h3-8,10,15H,9,11-12H2,1-2H3,(H,22,25)(H,23,27)/t15-/m0/s1 |
| InChIKey | UJDZVRHFQAWIPK-HNNXBMFYSA-N |
| XLogP | 1.23 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|