C21H24N4O5 — CID 110209763
2-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 110209763) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 110209763 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | COc1ccc(CCN2C(=O)NC(CC(=O)NCc3ccccn3)C2=O)cc1OC |
| InChI | InChI=1S/C21H24N4O5/c1-29-17-7-6-14(11-18(17)30-2)8-10-25-20(27)16(24-21(25)28)12-19(26)23-13-15-5-3-4-9-22-15/h3-7,9,11,16H,8,10,12-13H2,1-2H3,(H,23,26)(H,24,28) |
| InChIKey | NQSXRWSRSIEGCI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|