C23H27N3O5 — CID 91636561
N-benzyl-2-[(4S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-methylacetamide (PubChem CID 91636561) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-benzyl-2-[(4S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-methylacetamide.
| Compound Name | N-benzyl-2-[(4S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 91636561 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-benzyl-2-[(4S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-methylacetamide |
| SMILES | COc1ccc(CCN2C(=O)N[C@@H](CC(=O)N(C)Cc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C23H27N3O5/c1-25(15-17-7-5-4-6-8-17)21(27)14-18-22(28)26(23(29)24-18)12-11-16-9-10-19(30-2)20(13-16)31-3/h4-10,13,18H,11-12,14-15H2,1-3H3,(H,24,29)/t18-/m0/s1 |
| InChIKey | UZNCWPAXYPSMMJ-SFHVURJKSA-N |
| XLogP | 2.22 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|