C24H27N3O5 — CID 75356598
5-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 75356598) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is 5-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75356598 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 5-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)CC1NC(=O)N(CCc3ccccc3)C1=O)CC2 |
| InChI | InChI=1S/C24H27N3O5/c1-31-20-12-17-9-10-26(15-18(17)13-21(20)32-2)22(28)14-19-23(29)27(24(30)25-19)11-8-16-6-4-3-5-7-16/h3-7,12-13,19H,8-11,14-15H2,1-2H3,(H,25,30) |
| InChIKey | AQDYSCSJQNXSOU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|