C22H24N4O5 — CID 91823187
5-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 91823187) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 5-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91823187 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 5-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C(CC1NC(=O)N(CCc2ccccc2)C1=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H24N4O5/c27-19(24-10-12-25(13-11-24)21(29)18-7-4-14-31-18)15-17-20(28)26(22(30)23-17)9-8-16-5-2-1-3-6-16/h1-7,14,17H,8-13,15H2,(H,23,30) |
| InChIKey | HTYMKVJZPRPQIN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|