C26H30N4O3 — CID 71705445
5-[2-oxo-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 71705445) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is 5-[2-oxo-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[2-oxo-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71705445 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 5-[2-oxo-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]ethyl]-3-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C(CC1NC(=O)N(CCc2ccccc2)C1=O)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N4O3/c31-24(29-18-16-28(17-19-29)14-7-12-21-8-3-1-4-9-21)20-23-25(32)30(26(33)27-23)15-13-22-10-5-2-6-11-22/h1-12,23H,13-20H2,(H,27,33)/b12-7+ |
| InChIKey | KJNUKRFRSXBLNO-KPKJPENVSA-N |
| XLogP | 2.40 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|