C15H18N2O3 — CID 12051420
2-oxo-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetic acid (PubChem CID 12051420) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-oxo-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-oxo-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 12051420 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-oxo-2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetic acid |
| SMILES | O=C(O)C(=O)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C15H18N2O3/c18-14(15(19)20)17-11-9-16(10-12-17)8-4-7-13-5-2-1-3-6-13/h1-7H,8-12H2,(H,19,20)/b7-4+ |
| InChIKey | XAIPZNJHNXUGPC-QPJJXVBHSA-N |
| XLogP | 0.93 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|