C18H24N2O2 — CID 110374219
1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pentane-1,4-dione (PubChem CID 110374219) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pentane-1,4-dione.
| Compound Name | 1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 110374219 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N2O2/c1-16(21)9-10-18(22)20-14-12-19(13-15-20)11-5-8-17-6-3-2-4-7-17/h2-8H,9-15H2,1H3/b8-5+ |
| InChIKey | ZGDUSWLEAFXOCV-VMPITWQZSA-N |
| XLogP | 2.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |