C24H30N2O — CID 55771645
4-(4-methylphenyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]butan-1-one (PubChem CID 55771645) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-methylphenyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55771645 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 4-(4-methylphenyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]butan-1-one |
| SMILES | Cc1ccc(CCCC(=O)N2CCN(C/C=C/c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O/c1-21-12-14-23(15-13-21)9-5-11-24(27)26-19-17-25(18-20-26)16-6-10-22-7-3-2-4-8-22/h2-4,6-8,10,12-15H,5,9,11,16-20H2,1H3/b10-6+ |
| InChIKey | ILGLSTIRZHBACV-UXBLZVDNSA-N |
| XLogP | 4.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |