C17H21N3O3 — CID 2704050
(5R)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 2704050) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is (5R)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2704050 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (5R)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)N[C@H](CCc2ccccc2)C1=O)N1CCCC1 |
| InChI | InChI=1S/C17H21N3O3/c21-15(19-10-4-5-11-19)12-20-16(22)14(18-17(20)23)9-8-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,18,23)/t14-/m1/s1 |
| InChIKey | SFNZEWYHKBHPQP-CQSZACIVSA-N |
| XLogP | 1.16 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|