C27H25N3O3S — CID 45353619
3-[2-oxo-2-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 45353619) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is 3-[2-oxo-2-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-oxo-2-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45353619 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 3-[2-oxo-2-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(CCc2ccccc2)C(=O)N1CC(=O)N1c2ccccc2SCC1c1ccccc1 |
| InChI | InChI=1S/C27H25N3O3S/c31-25(17-29-26(32)21(28-27(29)33)16-15-19-9-3-1-4-10-19)30-22-13-7-8-14-24(22)34-18-23(30)20-11-5-2-6-12-20/h1-14,21,23H,15-18H2,(H,28,33) |
| InChIKey | MONSUOZKXGRTJX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|