C21H22N4O4S — CID 41215552
(5S)-5-benzyl-3-[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl]imidazolidine-2,4-dione (PubChem CID 41215552) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is (5S)-5-benzyl-3-[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41215552 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (5S)-5-benzyl-3-[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl]imidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)N[C@@H](Cc2ccccc2)C1=O)N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C21H22N4O4S/c26-18(23-8-10-24(11-9-23)20(28)17-7-4-12-30-17)14-25-19(27)16(22-21(25)29)13-15-5-2-1-3-6-15/h1-7,12,16H,8-11,13-14H2,(H,22,29)/t16-/m0/s1 |
| InChIKey | LTMGXOHVWYBAMA-INIZCTEOSA-N |
| XLogP | 1.20 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|