C20H22ClN3O3S — CID 146064906
2-benzyl-8-(thiophene-2-carbonyl)-3,6,7,9,10,10a-hexahydropyrazino[1,2-d][1,4]diazepine-1,4-dione;hydrochloride (PubChem CID 146064906) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is 2-benzyl-8-(thiophene-2-carbonyl)-3,6,7,9,10,10a-hexahydropyrazino[1,2-d][1,4]diazepine-1,4-dione;hydrochloride.
| Compound Name | 2-benzyl-8-(thiophene-2-carbonyl)-3,6,7,9,10,10a-hexahydropyrazino[1,2-d][1,4]diazepine-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 146064906 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-benzyl-8-(thiophene-2-carbonyl)-3,6,7,9,10,10a-hexahydropyrazino[1,2-d][1,4]diazepine-1,4-dione;hydrochloride |
| SMILES | Cl.O=C(c1cccs1)N1CCC2C(=O)N(Cc3ccccc3)CC(=O)N2CC1 |
| InChI | InChI=1S/C20H21N3O3S.ClH/c24-18-14-22(13-15-5-2-1-3-6-15)19(25)16-8-9-21(10-11-23(16)18)20(26)17-7-4-12-27-17;/h1-7,12,16H,8-11,13-14H2;1H |
| InChIKey | WWGPVVFCYICSEU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |