C17H21N2OS+ — CID 7162031
[4-(2-phenylethyl)piperazin-4-ium-1-yl]-thiophen-2-ylmethanone (PubChem CID 7162031) has the molecular formula C17H21N2OS+ and a molecular weight of 301.44 g/mol. Its IUPAC name is [4-(2-phenylethyl)piperazin-4-ium-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(2-phenylethyl)piperazin-4-ium-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 7162031 |
| Molecular Formula | C17H21N2OS+ |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | [4-(2-phenylethyl)piperazin-4-ium-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CC[NH+](CCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H20N2OS/c20-17(16-7-4-14-21-16)19-12-10-18(11-13-19)9-8-15-5-2-1-3-6-15/h1-7,14H,8-13H2/p+1 |
| InChIKey | YQDDUQZYJHPLDS-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |