C11H16N2OS — CID 20723386
(4-methanidyl-1,4-diazepan-4-ium-1-yl)-thiophen-2-ylmethanone (PubChem CID 20723386) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is (4-methanidyl-1,4-diazepan-4-ium-1-yl)-thiophen-2-ylmethanone.
| Compound Name | (4-methanidyl-1,4-diazepan-4-ium-1-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 20723386 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (4-methanidyl-1,4-diazepan-4-ium-1-yl)-thiophen-2-ylmethanone |
| SMILES | [CH2-][NH+]1CCCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C11H16N2OS/c1-12-5-3-6-13(8-7-12)11(14)10-4-2-9-15-10/h2,4,9,12H,1,3,5-8H2 |
| InChIKey | SVJLZUNYRYWGAY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|