C11H17N2OS+ — CID 6965529
(4-ethylpiperazin-4-ium-1-yl)-thiophen-2-ylmethanone (PubChem CID 6965529) has the molecular formula C11H17N2OS+ and a molecular weight of 225.34 g/mol. Its IUPAC name is (4-ethylpiperazin-4-ium-1-yl)-thiophen-2-ylmethanone.
| Compound Name | (4-ethylpiperazin-4-ium-1-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 6965529 |
| Molecular Formula | C11H17N2OS+ |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (4-ethylpiperazin-4-ium-1-yl)-thiophen-2-ylmethanone |
| SMILES | CC[NH+]1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C11H16N2OS/c1-2-12-5-7-13(8-6-12)11(14)10-4-3-9-15-10/h3-4,9H,2,5-8H2,1H3/p+1 |
| InChIKey | JUGKNURRKFYERN-UHFFFAOYSA-O |
| XLogP | 0.11 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |