C16H20N3O2S2+ — CID 4230629
N-[2-[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]ethyl]thiophene-2-carboxamide (PubChem CID 4230629) has the molecular formula C16H20N3O2S2+ and a molecular weight of 350.49 g/mol. Its IUPAC name is N-[2-[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4230629 |
| Molecular Formula | C16H20N3O2S2+ |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[2-[4-(thiophene-2-carbonyl)piperazin-1-ium-1-yl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC[NH+]1CCN(C(=O)c2cccs2)CC1)c1cccs1 |
| InChI | InChI=1S/C16H19N3O2S2/c20-15(13-3-1-11-22-13)17-5-6-18-7-9-19(10-8-18)16(21)14-4-2-12-23-14/h1-4,11-12H,5-10H2,(H,17,20)/p+1 |
| InChIKey | BOXSLRBGWLCOMK-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |