C11H17N2O2S+ — CID 6949050
N-(2-morpholin-4-ium-4-ylethyl)thiophene-2-carboxamide (PubChem CID 6949050) has the molecular formula C11H17N2O2S+ and a molecular weight of 241.34 g/mol. Its IUPAC name is N-(2-morpholin-4-ium-4-ylethyl)thiophene-2-carboxamide.
| Compound Name | N-(2-morpholin-4-ium-4-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6949050 |
| Molecular Formula | C11H17N2O2S+ |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-(2-morpholin-4-ium-4-ylethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C11H16N2O2S/c14-11(10-2-1-9-16-10)12-3-4-13-5-7-15-8-6-13/h1-2,9H,3-8H2,(H,12,14)/p+1 |
| InChIKey | LGBGZNHEADAJIV-UHFFFAOYSA-O |
| XLogP | -0.61 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |