C16H25N2O3S+ — CID 7243535
N-(2-morpholin-4-ium-4-ylethyl)-4-thiophen-2-yloxane-4-carboxamide (PubChem CID 7243535) has the molecular formula C16H25N2O3S+ and a molecular weight of 325.45 g/mol. Its IUPAC name is N-(2-morpholin-4-ium-4-ylethyl)-4-thiophen-2-yloxane-4-carboxamide.
| Compound Name | N-(2-morpholin-4-ium-4-ylethyl)-4-thiophen-2-yloxane-4-carboxamide |
|---|---|
| PubChem CID | 7243535 |
| Molecular Formula | C16H25N2O3S+ |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | N-(2-morpholin-4-ium-4-ylethyl)-4-thiophen-2-yloxane-4-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)C1(c2cccs2)CCOCC1 |
| InChI | InChI=1S/C16H24N2O3S/c19-15(17-5-6-18-7-11-21-12-8-18)16(3-9-20-10-4-16)14-2-1-13-22-14/h1-2,13H,3-12H2,(H,17,19)/p+1 |
| InChIKey | RGGCXBBEHPHHON-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |