C16H16FNO2S — CID 7243546
N-(2-fluorophenyl)-4-thiophen-2-yloxane-4-carboxamide (PubChem CID 7243546) has the molecular formula C16H16FNO2S and a molecular weight of 305.37 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-thiophen-2-yloxane-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-thiophen-2-yloxane-4-carboxamide |
|---|---|
| PubChem CID | 7243546 |
| Molecular Formula | C16H16FNO2S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(2-fluorophenyl)-4-thiophen-2-yloxane-4-carboxamide |
| SMILES | O=C(Nc1ccccc1F)C1(c2cccs2)CCOCC1 |
| InChI | InChI=1S/C16H16FNO2S/c17-12-4-1-2-5-13(12)18-15(19)16(7-9-20-10-8-16)14-6-3-11-21-14/h1-6,11H,7-10H2,(H,18,19) |
| InChIKey | AQOXDDKYDYQGMF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |