C22H27NO2S2 — CID 90523284
N-[(4-phenylsulfanyloxan-4-yl)methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 90523284) has the molecular formula C22H27NO2S2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-[(4-phenylsulfanyloxan-4-yl)methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[(4-phenylsulfanyloxan-4-yl)methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 90523284 |
| Molecular Formula | C22H27NO2S2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[(4-phenylsulfanyloxan-4-yl)methyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | O=C(NCC1(Sc2ccccc2)CCOCC1)C1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C22H27NO2S2/c24-20(22(10-4-5-11-22)19-9-6-16-26-19)23-17-21(12-14-25-15-13-21)27-18-7-2-1-3-8-18/h1-3,6-9,16H,4-5,10-15,17H2,(H,23,24) |
| InChIKey | SCHBEOHFMOHYDE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |