C16H22N2O2S — CID 90604890
1-cyclopropyl-3-[(4-phenylsulfanyloxan-4-yl)methyl]urea (PubChem CID 90604890) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(4-phenylsulfanyloxan-4-yl)methyl]urea.
| Compound Name | 1-cyclopropyl-3-[(4-phenylsulfanyloxan-4-yl)methyl]urea |
|---|---|
| PubChem CID | 90604890 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-cyclopropyl-3-[(4-phenylsulfanyloxan-4-yl)methyl]urea |
| SMILES | O=C(NCC1(Sc2ccccc2)CCOCC1)NC1CC1 |
| InChI | InChI=1S/C16H22N2O2S/c19-15(18-13-6-7-13)17-12-16(8-10-20-11-9-16)21-14-4-2-1-3-5-14/h1-5,13H,6-12H2,(H2,17,18,19) |
| InChIKey | OLCCLJSALCWTCM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |