C22H25N3O4S — CID 90604856
N'-(4-acetamidophenyl)-N-[(4-phenylsulfanyloxan-4-yl)methyl]oxamide (PubChem CID 90604856) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N'-(4-acetamidophenyl)-N-[(4-phenylsulfanyloxan-4-yl)methyl]oxamide.
| Compound Name | N'-(4-acetamidophenyl)-N-[(4-phenylsulfanyloxan-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 90604856 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N'-(4-acetamidophenyl)-N-[(4-phenylsulfanyloxan-4-yl)methyl]oxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(=O)NCC2(Sc3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-16(26)24-17-7-9-18(10-8-17)25-21(28)20(27)23-15-22(11-13-29-14-12-22)30-19-5-3-2-4-6-19/h2-10H,11-15H2,1H3,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | BMNVBBXYNOUFOT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|