C21H21F3N2O3S — CID 90604873
N-[(4-phenylsulfanyloxan-4-yl)methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 90604873) has the molecular formula C21H21F3N2O3S and a molecular weight of 438.47 g/mol. Its IUPAC name is N-[(4-phenylsulfanyloxan-4-yl)methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[(4-phenylsulfanyloxan-4-yl)methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 90604873 |
| Molecular Formula | C21H21F3N2O3S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[(4-phenylsulfanyloxan-4-yl)methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(NCC1(Sc2ccccc2)CCOCC1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F3N2O3S/c22-21(23,24)15-5-4-6-16(13-15)26-19(28)18(27)25-14-20(9-11-29-12-10-20)30-17-7-2-1-3-8-17/h1-8,13H,9-12,14H2,(H,25,27)(H,26,28) |
| InChIKey | OLBYSTOGZWGHNC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|