C22H23F3N2O4 — CID 27452763
N-[[4-(2-methoxyphenyl)oxan-4-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 27452763) has the molecular formula C22H23F3N2O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is N-[[4-(2-methoxyphenyl)oxan-4-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-[[4-(2-methoxyphenyl)oxan-4-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 27452763 |
| Molecular Formula | C22H23F3N2O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[[4-(2-methoxyphenyl)oxan-4-yl]methyl]-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | COc1ccccc1C1(CNC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)CCOCC1 |
| InChI | InChI=1S/C22H23F3N2O4/c1-30-18-8-3-2-7-17(18)21(9-11-31-12-10-21)14-26-19(28)20(29)27-16-6-4-5-15(13-16)22(23,24)25/h2-8,13H,9-12,14H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | OISJPCXUHRJZLP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|