C22H26N2O5 — CID 7647050
N'-(2-methoxyphenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]oxamide (PubChem CID 7647050) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]oxamide.
| Compound Name | N'-(2-methoxyphenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7647050 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N'-(2-methoxyphenyl)-N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]oxamide |
| SMILES | COc1ccc(C2(CNC(=O)C(=O)Nc3ccccc3OC)CCOCC2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-27-17-9-7-16(8-10-17)22(11-13-29-14-12-22)15-23-20(25)21(26)24-18-5-3-4-6-19(18)28-2/h3-10H,11-15H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | OXIZPZZANIGKNO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|