C24H30N2O4 — CID 27452245
N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-(4-propan-2-ylphenyl)oxamide (PubChem CID 27452245) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-(4-propan-2-ylphenyl)oxamide.
| Compound Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-(4-propan-2-ylphenyl)oxamide |
|---|---|
| PubChem CID | 27452245 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-(4-propan-2-ylphenyl)oxamide |
| SMILES | COc1ccc(C2(CNC(=O)C(=O)Nc3ccc(C(C)C)cc3)CCOCC2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-17(2)18-4-8-20(9-5-18)26-23(28)22(27)25-16-24(12-14-30-15-13-24)19-6-10-21(29-3)11-7-19/h4-11,17H,12-16H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | MHKOCIZGHKOOQW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|