C22H27NO4 — CID 133228915
2-(4-methoxyphenoxy)-N-[(4-phenyloxan-4-yl)methyl]propanamide (PubChem CID 133228915) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[(4-phenyloxan-4-yl)methyl]propanamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[(4-phenyloxan-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 133228915 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[(4-phenyloxan-4-yl)methyl]propanamide |
| SMILES | COc1ccc(OC(C)C(=O)NCC2(c3ccccc3)CCOCC2)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-17(27-20-10-8-19(25-2)9-11-20)21(24)23-16-22(12-14-26-15-13-22)18-6-4-3-5-7-18/h3-11,17H,12-16H2,1-2H3,(H,23,24) |
| InChIKey | YAOZQHIAYPNEHF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |