C23H28ClNO3 — CID 133160705
2-(4-chloro-3-methylphenoxy)-N-[(4-phenyloxan-4-yl)methyl]butanamide (PubChem CID 133160705) has the molecular formula C23H28ClNO3 and a molecular weight of 401.93 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[(4-phenyloxan-4-yl)methyl]butanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[(4-phenyloxan-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 133160705 |
| Molecular Formula | C23H28ClNO3 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[(4-phenyloxan-4-yl)methyl]butanamide |
| SMILES | CCC(Oc1ccc(Cl)c(C)c1)C(=O)NCC1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C23H28ClNO3/c1-3-21(28-19-9-10-20(24)17(2)15-19)22(26)25-16-23(11-13-27-14-12-23)18-7-5-4-6-8-18/h4-10,15,21H,3,11-14,16H2,1-2H3,(H,25,26) |
| InChIKey | ZOJFOEFGDXKSIA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |