C18H26ClNO3 — CID 94669671
(2S)-N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-2-ethoxybutanamide (PubChem CID 94669671) has the molecular formula C18H26ClNO3 and a molecular weight of 339.86 g/mol. Its IUPAC name is (2S)-N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-2-ethoxybutanamide.
| Compound Name | (2S)-N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-2-ethoxybutanamide |
|---|---|
| PubChem CID | 94669671 |
| Molecular Formula | C18H26ClNO3 |
| Molecular Weight | 339.86 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (2S)-N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-2-ethoxybutanamide |
| SMILES | CCO[C@@H](CC)C(=O)NCC1(c2cccc(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C18H26ClNO3/c1-3-16(23-4-2)17(21)20-13-18(8-10-22-11-9-18)14-6-5-7-15(19)12-14/h5-7,12,16H,3-4,8-11,13H2,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | MSXTUWSQBUHNQR-INIZCTEOSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |