C20H22ClNO4 — CID 56581235
N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-2-hydroxy-4-methoxybenzamide (PubChem CID 56581235) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 56581235 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC2(c3cccc(Cl)c3)CCOCC2)c(O)c1 |
| InChI | InChI=1S/C20H22ClNO4/c1-25-16-5-6-17(18(23)12-16)19(24)22-13-20(7-9-26-10-8-20)14-3-2-4-15(21)11-14/h2-6,11-12,23H,7-10,13H2,1H3,(H,22,24) |
| InChIKey | IUNVEIPRMKCTLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |