C19H18BrClFNO2 — CID 55865048
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-chloro-2-fluorobenzamide (PubChem CID 55865048) has the molecular formula C19H18BrClFNO2 and a molecular weight of 426.71 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-chloro-2-fluorobenzamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 55865048 |
| Molecular Formula | C19H18BrClFNO2 |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-chloro-2-fluorobenzamide |
| SMILES | O=C(NCC1(c2cccc(Br)c2)CCOCC1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C19H18BrClFNO2/c20-14-3-1-2-13(10-14)19(6-8-25-9-7-19)12-23-18(24)16-11-15(21)4-5-17(16)22/h1-5,10-11H,6-9,12H2,(H,23,24) |
| InChIKey | XADNWTZHMUZMKN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |