C21H19BrClNO3 — CID 55862229
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-chloro-1-benzofuran-2-carboxamide (PubChem CID 55862229) has the molecular formula C21H19BrClNO3 and a molecular weight of 448.74 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-chloro-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-chloro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55862229 |
| Molecular Formula | C21H19BrClNO3 |
| Molecular Weight | 448.74 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-5-chloro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCC1(c2cccc(Br)c2)CCOCC1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C21H19BrClNO3/c22-16-3-1-2-15(12-16)21(6-8-26-9-7-21)13-24-20(25)19-11-14-10-17(23)4-5-18(14)27-19/h1-5,10-12H,6-9,13H2,(H,24,25) |
| InChIKey | RFLSEHAKCMKGQJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.74 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |