C19H17BrCl2FNO2 — CID 60524831
N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-2,4-dichloro-5-fluorobenzamide (PubChem CID 60524831) has the molecular formula C19H17BrCl2FNO2 and a molecular weight of 461.16 g/mol. Its IUPAC name is N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 60524831 |
| Molecular Formula | C19H17BrCl2FNO2 |
| Molecular Weight | 461.16 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | N-[[4-(3-bromophenyl)oxan-4-yl]methyl]-2,4-dichloro-5-fluorobenzamide |
| SMILES | O=C(NCC1(c2cccc(Br)c2)CCOCC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H17BrCl2FNO2/c20-13-3-1-2-12(8-13)19(4-6-26-7-5-19)11-24-18(25)14-9-17(23)16(22)10-15(14)21/h1-3,8-10H,4-7,11H2,(H,24,25) |
| InChIKey | CEJHONUCOOWJFX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.16 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|