C13H14Cl2FNO3 — CID 79039031
2,4-dichloro-5-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide (PubChem CID 79039031) has the molecular formula C13H14Cl2FNO3 and a molecular weight of 322.16 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 79039031 |
| Molecular Formula | C13H14Cl2FNO3 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCOCC1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2FNO3/c14-9-6-10(15)11(16)5-8(9)12(18)17-7-13(19)1-3-20-4-2-13/h5-6,19H,1-4,7H2,(H,17,18) |
| InChIKey | CQQAKMPDNKFJGS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|