C13H16Cl2N2O3 — CID 82833099
4-amino-3,5-dichloro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide (PubChem CID 82833099) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 82833099 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCC2(O)CCOCC2)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O3/c14-9-5-8(6-10(15)11(9)16)12(18)17-7-13(19)1-3-20-4-2-13/h5-6,19H,1-4,7,16H2,(H,17,18) |
| InChIKey | JWAGKHJFFGJXLC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|