C15H20Cl2N2O2 — CID 65123513
3-amino-4,5-dichloro-N-[(1-hydroxycycloheptyl)methyl]benzamide (PubChem CID 65123513) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-[(1-hydroxycycloheptyl)methyl]benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-[(1-hydroxycycloheptyl)methyl]benzamide |
|---|---|
| PubChem CID | 65123513 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-amino-4,5-dichloro-N-[(1-hydroxycycloheptyl)methyl]benzamide |
| SMILES | Nc1cc(C(=O)NCC2(O)CCCCCC2)cc(Cl)c1Cl |
| InChI | InChI=1S/C15H20Cl2N2O2/c16-11-7-10(8-12(18)13(11)17)14(20)19-9-15(21)5-3-1-2-4-6-15/h7-8,21H,1-6,9,18H2,(H,19,20) |
| InChIKey | LNFZAISTWWEAKX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|