C13H15Cl2NO3 — CID 71989539
2,5-dichloro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide (PubChem CID 71989539) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 71989539 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2,5-dichloro-N-[(4-hydroxyoxan-4-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCOCC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H15Cl2NO3/c14-9-1-2-11(15)10(7-9)12(17)16-8-13(18)3-5-19-6-4-13/h1-2,7,18H,3-6,8H2,(H,16,17) |
| InChIKey | NIVQDLUUQLYPCS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |