C12H12ClF2NO3 — CID 103848658
2-chloro-4,5-difluoro-N-[(3-hydroxyoxolan-3-yl)methyl]benzamide (PubChem CID 103848658) has the molecular formula C12H12ClF2NO3 and a molecular weight of 291.68 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[(3-hydroxyoxolan-3-yl)methyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[(3-hydroxyoxolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 103848658 |
| Molecular Formula | C12H12ClF2NO3 |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[(3-hydroxyoxolan-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCOC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C12H12ClF2NO3/c13-8-4-10(15)9(14)3-7(8)11(17)16-5-12(18)1-2-19-6-12/h3-4,18H,1-2,5-6H2,(H,16,17) |
| InChIKey | BWVGIJVOMDZXHC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|