C12H13F2NO3 — CID 113337991
2,5-difluoro-N-[(3-hydroxyoxolan-3-yl)methyl]benzamide (PubChem CID 113337991) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 2,5-difluoro-N-[(3-hydroxyoxolan-3-yl)methyl]benzamide.
| Compound Name | 2,5-difluoro-N-[(3-hydroxyoxolan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 113337991 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2,5-difluoro-N-[(3-hydroxyoxolan-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1(O)CCOC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H13F2NO3/c13-8-1-2-10(14)9(5-8)11(16)15-6-12(17)3-4-18-7-12/h1-2,5,17H,3-4,6-7H2,(H,15,16) |
| InChIKey | MDBKDPGNQIOJEB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |