C13H14Cl2N2O3 — CID 82833458
1-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]cyclobutane-1-carboxylic acid (PubChem CID 82833458) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is 1-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 82833458 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 1-[[(4-amino-3,5-dichlorobenzoyl)amino]methyl]cyclobutane-1-carboxylic acid |
| SMILES | Nc1c(Cl)cc(C(=O)NCC2(C(=O)O)CCC2)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3/c14-8-4-7(5-9(15)10(8)16)11(18)17-6-13(12(19)20)2-1-3-13/h4-5H,1-3,6,16H2,(H,17,18)(H,19,20) |
| InChIKey | WAIDBELKVQFBDL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|