C15H17F2NO3 — CID 115435644
1-[[(3,5-difluorobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 115435644) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is 1-[[(3,5-difluorobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(3,5-difluorobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115435644 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 1-[[(3,5-difluorobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCCCC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H17F2NO3/c16-11-6-10(7-12(17)8-11)13(19)18-9-15(14(20)21)4-2-1-3-5-15/h6-8H,1-5,9H2,(H,18,19)(H,20,21) |
| InChIKey | GYQQPWWZTIHSOF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |