C14H18F2N2O — CID 119404038
N-[(1-aminocyclohexyl)methyl]-3,5-difluorobenzamide (PubChem CID 119404038) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[(1-aminocyclohexyl)methyl]-3,5-difluorobenzamide.
| Compound Name | N-[(1-aminocyclohexyl)methyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 119404038 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[(1-aminocyclohexyl)methyl]-3,5-difluorobenzamide |
| SMILES | NC1(CNC(=O)c2cc(F)cc(F)c2)CCCCC1 |
| InChI | InChI=1S/C14H18F2N2O/c15-11-6-10(7-12(16)8-11)13(19)18-9-14(17)4-2-1-3-5-14/h6-8H,1-5,9,17H2,(H,18,19) |
| InChIKey | OTILEINVBPKSSD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |