C14H19F2N3O — CID 61298666
1-[(1-aminocyclohexyl)methyl]-3-(2,4-difluorophenyl)urea (PubChem CID 61298666) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-[(1-aminocyclohexyl)methyl]-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-[(1-aminocyclohexyl)methyl]-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 61298666 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-[(1-aminocyclohexyl)methyl]-3-(2,4-difluorophenyl)urea |
| SMILES | NC1(CNC(=O)Nc2ccc(F)cc2F)CCCCC1 |
| InChI | InChI=1S/C14H19F2N3O/c15-10-4-5-12(11(16)8-10)19-13(20)18-9-14(17)6-2-1-3-7-14/h4-5,8H,1-3,6-7,9,17H2,(H2,18,19,20) |
| InChIKey | UKSMMMUGZNLWLD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |