C15H16F2N2O — CID 3719887
1-(2,4-difluorophenyl)-3-(1-ethynylcyclohexyl)urea (PubChem CID 3719887) has the molecular formula C15H16F2N2O and a molecular weight of 278.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(1-ethynylcyclohexyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(1-ethynylcyclohexyl)urea |
|---|---|
| PubChem CID | 3719887 |
| Molecular Formula | C15H16F2N2O |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(1-ethynylcyclohexyl)urea |
| SMILES | C#CC1(NC(=O)Nc2ccc(F)cc2F)CCCCC1 |
| InChI | InChI=1S/C15H16F2N2O/c1-2-15(8-4-3-5-9-15)19-14(20)18-13-7-6-11(16)10-12(13)17/h1,6-7,10H,3-5,8-9H2,(H2,18,19,20) |
| InChIKey | WEGKUFDVJYMCGI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|