C13H14F2N2O — CID 108913742
1-(cyclopentylidenemethyl)-3-(2,4-difluorophenyl)urea (PubChem CID 108913742) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is 1-(cyclopentylidenemethyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(cyclopentylidenemethyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 108913742 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-(cyclopentylidenemethyl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(NC=C1CCCC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2N2O/c14-10-5-6-12(11(15)7-10)17-13(18)16-8-9-3-1-2-4-9/h5-8H,1-4H2,(H2,16,17,18) |
| InChIKey | KFOXNISUYIFOJU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |